C22H32Cl3NO4Si — CID 134847688
ethyl (E,4R)-4-[benzyl-(2,2,2-trichloroacetyl)amino]-5-[tert-butyl(dimethyl)silyl]oxypent-2-enoate (PubChem CID 134847688) has the molecular formula C22H32Cl3NO4Si and a molecular weight of 508.95 g/mol. Its IUPAC name is ethyl (E,4R)-4-[benzyl-(2,2,2-trichloroacetyl)amino]-5-[tert-butyl(dimethyl)silyl]oxypent-2-enoate.
| Compound Name | ethyl (E,4R)-4-[benzyl-(2,2,2-trichloroacetyl)amino]-5-[tert-butyl(dimethyl)silyl]oxypent-2-enoate |
|---|---|
| PubChem CID | 134847688 |
| Molecular Formula | C22H32Cl3NO4Si |
| Molecular Weight | 508.95 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | ethyl (E,4R)-4-[benzyl-(2,2,2-trichloroacetyl)amino]-5-[tert-butyl(dimethyl)silyl]oxypent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CO[Si](C)(C)C(C)(C)C)N(Cc1ccccc1)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H32Cl3NO4Si/c1-7-29-19(27)14-13-18(16-30-31(5,6)21(2,3)4)26(20(28)22(23,24)25)15-17-11-9-8-10-12-17/h8-14,18H,7,15-16H2,1-6H3/b14-13+/t18-/m1/s1 |
| InChIKey | WMGOJSAHJNLESY-KAUXGEHWSA-N |
| XLogP | 5.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.95 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|