C22H36ClNO3Si — CID 23583351
methyl (2R)-2-[benzyl-[(E)-4-chloro-3-methylbut-2-enyl]amino]-3-[tert-butyl(dimethyl)silyl]oxypropanoate (PubChem CID 23583351) has the molecular formula C22H36ClNO3Si and a molecular weight of 426.07 g/mol. Its IUPAC name is methyl (2R)-2-[benzyl-[(E)-4-chloro-3-methylbut-2-enyl]amino]-3-[tert-butyl(dimethyl)silyl]oxypropanoate.
| Compound Name | methyl (2R)-2-[benzyl-[(E)-4-chloro-3-methylbut-2-enyl]amino]-3-[tert-butyl(dimethyl)silyl]oxypropanoate |
|---|---|
| PubChem CID | 23583351 |
| Molecular Formula | C22H36ClNO3Si |
| Molecular Weight | 426.07 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | methyl (2R)-2-[benzyl-[(E)-4-chloro-3-methylbut-2-enyl]amino]-3-[tert-butyl(dimethyl)silyl]oxypropanoate |
| SMILES | COC(=O)[C@@H](CO[Si](C)(C)C(C)(C)C)N(C/C=C(\C)CCl)Cc1ccccc1 |
| InChI | InChI=1S/C22H36ClNO3Si/c1-18(15-23)13-14-24(16-19-11-9-8-10-12-19)20(21(25)26-5)17-27-28(6,7)22(2,3)4/h8-13,20H,14-17H2,1-7H3/b18-13+/t20-/m1/s1 |
| InChIKey | DUWDNMBRXXDEFV-ITICKHJUSA-N |
| XLogP | 5.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.07 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|