C24H33NO4Si — CID 134877613
benzyl N-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-1-oxo-1-phenylpropan-2-yl]-N-methylcarbamate (PubChem CID 134877613) has the molecular formula C24H33NO4Si and a molecular weight of 427.62 g/mol. Its IUPAC name is benzyl N-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-1-oxo-1-phenylpropan-2-yl]-N-methylcarbamate.
| Compound Name | benzyl N-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-1-oxo-1-phenylpropan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 134877613 |
| Molecular Formula | C24H33NO4Si |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | benzyl N-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-1-oxo-1-phenylpropan-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OCc1ccccc1)[C@@H](CO[Si](C)(C)C(C)(C)C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H33NO4Si/c1-24(2,3)30(5,6)29-18-21(22(26)20-15-11-8-12-16-20)25(4)23(27)28-17-19-13-9-7-10-14-19/h7-16,21H,17-18H2,1-6H3/t21-/m0/s1 |
| InChIKey | RHLNSBFHIPEZSW-NRFANRHFSA-N |
| XLogP | 5.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|