C20H21NO6 — CID 91613771
(3S)-3-[methyl(phenylmethoxycarbonyl)amino]-4-oxo-4-phenylmethoxybutanoic acid (PubChem CID 91613771) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is (3S)-3-[methyl(phenylmethoxycarbonyl)amino]-4-oxo-4-phenylmethoxybutanoic acid.
| Compound Name | (3S)-3-[methyl(phenylmethoxycarbonyl)amino]-4-oxo-4-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 91613771 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (3S)-3-[methyl(phenylmethoxycarbonyl)amino]-4-oxo-4-phenylmethoxybutanoic acid |
| SMILES | CN(C(=O)OCc1ccccc1)[C@@H](CC(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H21NO6/c1-21(20(25)27-14-16-10-6-3-7-11-16)17(12-18(22)23)19(24)26-13-15-8-4-2-5-9-15/h2-11,17H,12-14H2,1H3,(H,22,23)/t17-/m0/s1 |
| InChIKey | RAYOMGMZKBGGSZ-KRWDZBQOSA-N |
| XLogP | 2.84 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |