C18H20LiNO4 — CID 174145351
lithium;hydride;(2S)-2-[methyl(phenylmethoxycarbonyl)amino]-3-phenylpropanoic acid (PubChem CID 174145351) has the molecular formula C18H20LiNO4 and a molecular weight of 321.30 g/mol. Its IUPAC name is lithium;hydride;(2S)-2-[methyl(phenylmethoxycarbonyl)amino]-3-phenylpropanoic acid.
| Compound Name | lithium;hydride;(2S)-2-[methyl(phenylmethoxycarbonyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 174145351 |
| Molecular Formula | C18H20LiNO4 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | lithium;hydride;(2S)-2-[methyl(phenylmethoxycarbonyl)amino]-3-phenylpropanoic acid |
| SMILES | CN(C(=O)OCc1ccccc1)[C@@H](Cc1ccccc1)C(=O)O.[H-].[Li+] |
| InChI | InChI=1S/C18H19NO4.Li.H/c1-19(18(22)23-13-15-10-6-3-7-11-15)16(17(20)21)12-14-8-4-2-5-9-14;;/h2-11,16H,12-13H2,1H3,(H,20,21);;/q;+1;-1/t16-;;/m0../s1 |
| InChIKey | ANTOZRFXKPTSEM-SQKCAUCHSA-N |
| XLogP | 0.07 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |