C19H19F2NO4 — CID 156691133
3-[4-(difluoromethyl)phenyl]-2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid (PubChem CID 156691133) has the molecular formula C19H19F2NO4 and a molecular weight of 363.36 g/mol. Its IUPAC name is 3-[4-(difluoromethyl)phenyl]-2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid.
| Compound Name | 3-[4-(difluoromethyl)phenyl]-2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 156691133 |
| Molecular Formula | C19H19F2NO4 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 3-[4-(difluoromethyl)phenyl]-2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid |
| SMILES | CN(C(=O)OCc1ccccc1)C(Cc1ccc(C(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C19H19F2NO4/c1-22(19(25)26-12-14-5-3-2-4-6-14)16(18(23)24)11-13-7-9-15(10-8-13)17(20)21/h2-10,16-17H,11-12H2,1H3,(H,23,24) |
| InChIKey | AINWATCQLFXJGV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |