C15H16Cl3NO6 — CID 163146300
2-[methyl(phenylmethoxycarbonyl)amino]-4-oxo-4-(2,2,2-trichloroethoxy)butanoic acid (PubChem CID 163146300) has the molecular formula C15H16Cl3NO6 and a molecular weight of 412.65 g/mol. Its IUPAC name is 2-[methyl(phenylmethoxycarbonyl)amino]-4-oxo-4-(2,2,2-trichloroethoxy)butanoic acid.
| Compound Name | 2-[methyl(phenylmethoxycarbonyl)amino]-4-oxo-4-(2,2,2-trichloroethoxy)butanoic acid |
|---|---|
| PubChem CID | 163146300 |
| Molecular Formula | C15H16Cl3NO6 |
| Molecular Weight | 412.65 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | 2-[methyl(phenylmethoxycarbonyl)amino]-4-oxo-4-(2,2,2-trichloroethoxy)butanoic acid |
| SMILES | CN(C(=O)OCc1ccccc1)C(CC(=O)OCC(Cl)(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C15H16Cl3NO6/c1-19(14(23)24-8-10-5-3-2-4-6-10)11(13(21)22)7-12(20)25-9-15(16,17)18/h2-6,11H,7-9H2,1H3,(H,21,22) |
| InChIKey | LSDGLHDSWZCIOW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.65 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|