C17H21Cl3N2O6 — CID 154345097
(2S)-6-amino-2-[phenylmethoxycarbonyl(2,2,2-trichloroethoxycarbonyl)amino]hexanoic acid (PubChem CID 154345097) has the molecular formula C17H21Cl3N2O6 and a molecular weight of 455.72 g/mol. Its IUPAC name is (2S)-6-amino-2-[phenylmethoxycarbonyl(2,2,2-trichloroethoxycarbonyl)amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[phenylmethoxycarbonyl(2,2,2-trichloroethoxycarbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 154345097 |
| Molecular Formula | C17H21Cl3N2O6 |
| Molecular Weight | 455.72 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | (2S)-6-amino-2-[phenylmethoxycarbonyl(2,2,2-trichloroethoxycarbonyl)amino]hexanoic acid |
| SMILES | NCCCC[C@@H](C(=O)O)N(C(=O)OCc1ccccc1)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H21Cl3N2O6/c18-17(19,20)11-28-16(26)22(13(14(23)24)8-4-5-9-21)15(25)27-10-12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-11,21H2,(H,23,24)/t13-/m0/s1 |
| InChIKey | CGLNJNQIMVVXAX-ZDUSSCGKSA-N |
| XLogP | 3.71 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.72 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|