C19H20Cl3NO2 — CID 102476943
2,2,2-trichloroethyl N-benzyl-N-(3-phenylpropyl)carbamate (PubChem CID 102476943) has the molecular formula C19H20Cl3NO2 and a molecular weight of 400.73 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-benzyl-N-(3-phenylpropyl)carbamate.
| Compound Name | 2,2,2-trichloroethyl N-benzyl-N-(3-phenylpropyl)carbamate |
|---|---|
| PubChem CID | 102476943 |
| Molecular Formula | C19H20Cl3NO2 |
| Molecular Weight | 400.73 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 2,2,2-trichloroethyl N-benzyl-N-(3-phenylpropyl)carbamate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)N(CCCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H20Cl3NO2/c20-19(21,22)15-25-18(24)23(14-17-10-5-2-6-11-17)13-7-12-16-8-3-1-4-9-16/h1-6,8-11H,7,12-15H2 |
| InChIKey | LHGWSINWUHXKPT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.73 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|