C16H21Cl3N2O5 — CID 14780277
methyl (2S)-2-amino-5-[phenylmethoxy(2,2,2-trichloroethoxycarbonyl)amino]pentanoate (PubChem CID 14780277) has the molecular formula C16H21Cl3N2O5 and a molecular weight of 427.71 g/mol. Its IUPAC name is methyl (2S)-2-amino-5-[phenylmethoxy(2,2,2-trichloroethoxycarbonyl)amino]pentanoate.
| Compound Name | methyl (2S)-2-amino-5-[phenylmethoxy(2,2,2-trichloroethoxycarbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 14780277 |
| Molecular Formula | C16H21Cl3N2O5 |
| Molecular Weight | 427.71 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | methyl (2S)-2-amino-5-[phenylmethoxy(2,2,2-trichloroethoxycarbonyl)amino]pentanoate |
| SMILES | COC(=O)[C@@H](N)CCCN(OCc1ccccc1)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H21Cl3N2O5/c1-24-14(22)13(20)8-5-9-21(15(23)25-11-16(17,18)19)26-10-12-6-3-2-4-7-12/h2-4,6-7,13H,5,8-11,20H2,1H3/t13-/m0/s1 |
| InChIKey | SMAUENPXZJWXRS-ZDUSSCGKSA-N |
| XLogP | 3.21 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.71 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|