C10H10Cl3NO3 — CID 132518639
2,2,2-trichloroethyl N-methoxy-N-phenylcarbamate (PubChem CID 132518639) has the molecular formula C10H10Cl3NO3 and a molecular weight of 298.55 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-methoxy-N-phenylcarbamate.
| Compound Name | 2,2,2-trichloroethyl N-methoxy-N-phenylcarbamate |
|---|---|
| PubChem CID | 132518639 |
| Molecular Formula | C10H10Cl3NO3 |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 296.97 |
| IUPAC Name | 2,2,2-trichloroethyl N-methoxy-N-phenylcarbamate |
| SMILES | CON(C(=O)OCC(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C10H10Cl3NO3/c1-16-14(8-5-3-2-4-6-8)9(15)17-7-10(11,12)13/h2-6H,7H2,1H3 |
| InChIKey | RJTMZHDFGNFXNT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|