About 1-methoxy-1-phenylurea
1-methoxy-1-phenylurea (PubChem CID 15620442) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 1-methoxy-1-phenylurea.
Molecular Properties
| Compound Name | 1-methoxy-1-phenylurea |
| PubChem CID | 15620442 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 1-methoxy-1-phenylurea |
| SMILES | CON(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C8H10N2O2/c1-12-10(8(9)11)7-5-3-2-4-6-7/h2-6H,1H3,(H2,9,11) |
| InChIKey | BZUZZQAYHNRJPW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-1-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-1-phenylurea?
The IUPAC name of 1-methoxy-1-phenylurea (CID 15620442) is 1-methoxy-1-phenylurea.
What is the SMILES notation for 1-methoxy-1-phenylurea?
The canonical SMILES for 1-methoxy-1-phenylurea is CON(C(N)=O)c1ccccc1.
What is the InChIKey of 1-methoxy-1-phenylurea?
The InChIKey is BZUZZQAYHNRJPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-12-10(8(9)11)7-5-3-2-4-6-7/h2-6H,1H3,(H2,9,11).
What are the key properties of 1-methoxy-1-phenylurea?
1-methoxy-1-phenylurea has a molecular weight of 166.18 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-1-phenylurea is sourced from PubChem (CID 15620442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).