C17H22N2O — CID 70397101
butane;1,1-diphenylurea (PubChem CID 70397101) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is butane;1,1-diphenylurea.
| Compound Name | butane;1,1-diphenylurea |
|---|---|
| PubChem CID | 70397101 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | butane;1,1-diphenylurea |
| SMILES | CCCC.NC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H12N2O.C4H10/c14-13(16)15(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-4-2/h1-10H,(H2,14,16);3-4H2,1-2H3 |
| InChIKey | YGCSTPRGIHCFAU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |