C15H16N2O2 — CID 162373128
3-ethoxy-1,1-diphenylurea (PubChem CID 162373128) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 3-ethoxy-1,1-diphenylurea.
| Compound Name | 3-ethoxy-1,1-diphenylurea |
|---|---|
| PubChem CID | 162373128 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-ethoxy-1,1-diphenylurea |
| SMILES | CCONC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16N2O2/c1-2-19-16-15(18)17(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3,(H,16,18) |
| InChIKey | XLGPWBOHKVTPNI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|