About 3-ethoxy-2-oxo-N,N-diphenylbutanamide
3-ethoxy-2-oxo-N,N-diphenylbutanamide (PubChem CID 174477182) has the molecular formula C18H19NO3
and a molecular weight of 297.35 g/mol. Its IUPAC name is 3-ethoxy-2-oxo-N,N-diphenylbutanamide.
Molecular Properties
| Compound Name | 3-ethoxy-2-oxo-N,N-diphenylbutanamide |
| PubChem CID | 174477182 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 3-ethoxy-2-oxo-N,N-diphenylbutanamide |
| SMILES | CCOC(C)C(=O)C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c1-3-22-14(2)17(20)18(21)19(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-14H,3H2,1-2H3 |
| InChIKey | CYCSLUKMKKJXOL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-2-oxo-N,N-diphenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2-oxo-N,N-diphenylbutanamide?
The IUPAC name of 3-ethoxy-2-oxo-N,N-diphenylbutanamide (CID 174477182) is 3-ethoxy-2-oxo-N,N-diphenylbutanamide.
What is the SMILES notation for 3-ethoxy-2-oxo-N,N-diphenylbutanamide?
The canonical SMILES for 3-ethoxy-2-oxo-N,N-diphenylbutanamide is CCOC(C)C(=O)C(=O)N(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-ethoxy-2-oxo-N,N-diphenylbutanamide?
The InChIKey is CYCSLUKMKKJXOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3/c1-3-22-14(2)17(20)18(21)19(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-14H,3H2,1-2H3.
What are the key properties of 3-ethoxy-2-oxo-N,N-diphenylbutanamide?
3-ethoxy-2-oxo-N,N-diphenylbutanamide has a molecular weight of 297.35 g/mol, XLogP of 3.35, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2-oxo-N,N-diphenylbutanamide is sourced from PubChem (CID 174477182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).