C30H28N2O4 — CID 141426633
N'-(3,4-diethoxyphenyl)-N,N,N'-triphenyloxamide (PubChem CID 141426633) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is N'-(3,4-diethoxyphenyl)-N,N,N'-triphenyloxamide.
| Compound Name | N'-(3,4-diethoxyphenyl)-N,N,N'-triphenyloxamide |
|---|---|
| PubChem CID | 141426633 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N'-(3,4-diethoxyphenyl)-N,N,N'-triphenyloxamide |
| SMILES | CCOc1ccc(N(C(=O)C(=O)N(c2ccccc2)c2ccccc2)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C30H28N2O4/c1-3-35-27-21-20-26(22-28(27)36-4-2)32(25-18-12-7-13-19-25)30(34)29(33)31(23-14-8-5-9-15-23)24-16-10-6-11-17-24/h5-22H,3-4H2,1-2H3 |
| InChIKey | AUUNSTVXCYQSDM-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|