C24H21ClN2O3S — CID 11419624
N-(1,3-benzothiazol-2-yl)-2-chloro-N-(3,4-diethoxyphenyl)benzamide (PubChem CID 11419624) has the molecular formula C24H21ClN2O3S and a molecular weight of 452.96 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-chloro-N-(3,4-diethoxyphenyl)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-chloro-N-(3,4-diethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 11419624 |
| Molecular Formula | C24H21ClN2O3S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-chloro-N-(3,4-diethoxyphenyl)benzamide |
| SMILES | CCOc1ccc(N(C(=O)c2ccccc2Cl)c2nc3ccccc3s2)cc1OCC |
| InChI | InChI=1S/C24H21ClN2O3S/c1-3-29-20-14-13-16(15-21(20)30-4-2)27(23(28)17-9-5-6-10-18(17)25)24-26-19-11-7-8-12-22(19)31-24/h5-15H,3-4H2,1-2H3 |
| InChIKey | LXBXFHCMWKBLBA-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |