C22H17ClN2OS — CID 2345159
N-(1,3-benzothiazol-2-yl)-4-chloro-N-(4-ethylphenyl)benzamide (PubChem CID 2345159) has the molecular formula C22H17ClN2OS and a molecular weight of 392.91 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-chloro-N-(4-ethylphenyl)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-chloro-N-(4-ethylphenyl)benzamide |
|---|---|
| PubChem CID | 2345159 |
| Molecular Formula | C22H17ClN2OS |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-chloro-N-(4-ethylphenyl)benzamide |
| SMILES | CCc1ccc(N(C(=O)c2ccc(Cl)cc2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C22H17ClN2OS/c1-2-15-7-13-18(14-8-15)25(21(26)16-9-11-17(23)12-10-16)22-24-19-5-3-4-6-20(19)27-22/h3-14H,2H2,1H3 |
| InChIKey | GKSDJMUXCACUFE-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |