C21H15ClN2O2S — CID 11280885
N-(1,3-benzothiazol-2-yl)-2-chloro-N-(4-methoxyphenyl)benzamide (PubChem CID 11280885) has the molecular formula C21H15ClN2O2S and a molecular weight of 394.88 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-chloro-N-(4-methoxyphenyl)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-chloro-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 11280885 |
| Molecular Formula | C21H15ClN2O2S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-chloro-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(N(C(=O)c2ccccc2Cl)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H15ClN2O2S/c1-26-15-12-10-14(11-13-15)24(20(25)16-6-2-3-7-17(16)22)21-23-18-8-4-5-9-19(18)27-21/h2-13H,1H3 |
| InChIKey | NWGLNYHHZREFNA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |