C22H16ClN3O5S — CID 11465553
2-chloro-N-(3,4-dimethoxyphenyl)-N-(6-nitro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 11465553) has the molecular formula C22H16ClN3O5S and a molecular weight of 469.91 g/mol. Its IUPAC name is 2-chloro-N-(3,4-dimethoxyphenyl)-N-(6-nitro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2-chloro-N-(3,4-dimethoxyphenyl)-N-(6-nitro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 11465553 |
| Molecular Formula | C22H16ClN3O5S |
| Molecular Weight | 469.91 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 2-chloro-N-(3,4-dimethoxyphenyl)-N-(6-nitro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | COc1ccc(N(C(=O)c2ccccc2Cl)c2nc3ccc([N+](=O)[O-])cc3s2)cc1OC |
| InChI | InChI=1S/C22H16ClN3O5S/c1-30-18-10-8-13(11-19(18)31-2)25(21(27)15-5-3-4-6-16(15)23)22-24-17-9-7-14(26(28)29)12-20(17)32-22/h3-12H,1-2H3 |
| InChIKey | XYJZDHDXKAFFAR-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.91 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|