C25H22N4O6S — CID 44944188
N-(6-methyl-1,3-benzothiazol-2-yl)-3-nitro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide (PubChem CID 44944188) has the molecular formula C25H22N4O6S and a molecular weight of 506.54 g/mol. Its IUPAC name is N-(6-methyl-1,3-benzothiazol-2-yl)-3-nitro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | N-(6-methyl-1,3-benzothiazol-2-yl)-3-nitro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44944188 |
| Molecular Formula | C25H22N4O6S |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | N-(6-methyl-1,3-benzothiazol-2-yl)-3-nitro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(/C=N/N(C(=O)c2cccc([N+](=O)[O-])c2)c2nc3ccc(C)cc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C25H22N4O6S/c1-15-8-9-19-22(10-15)36-25(27-19)28(24(30)17-6-5-7-18(13-17)29(31)32)26-14-16-11-20(33-2)23(35-4)21(12-16)34-3/h5-14H,1-4H3/b26-14+ |
| InChIKey | DXEVPHFFJWUYLB-VULFUBBASA-N |
| XLogP | 5.22 |
| TPSA | 116.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|