C23H20N4O6S2 — CID 44944832
3,4,5-trimethoxy-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide (PubChem CID 44944832) has the molecular formula C23H20N4O6S2 and a molecular weight of 512.57 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44944832 |
| Molecular Formula | C23H20N4O6S2 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | 3,4,5-trimethoxy-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
| SMILES | COc1cc(C(=O)N(/N=C/c2ccc([N+](=O)[O-])s2)c2nc3ccc(C)cc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C23H20N4O6S2/c1-13-5-7-16-19(9-13)35-23(25-16)26(24-12-15-6-8-20(34-15)27(29)30)22(28)14-10-17(31-2)21(33-4)18(11-14)32-3/h5-12H,1-4H3/b24-12+ |
| InChIKey | LTGZJGHSUBKUFC-WYMPLXKRSA-N |
| XLogP | 5.28 |
| TPSA | 116.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|