C20H13N5O6S2 — CID 44946037
N-(6-methoxy-1,3-benzothiazol-2-yl)-3-nitro-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide (PubChem CID 44946037) has the molecular formula C20H13N5O6S2 and a molecular weight of 483.49 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-3-nitro-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-3-nitro-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44946037 |
| Molecular Formula | C20H13N5O6S2 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-3-nitro-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
| SMILES | COc1ccc2nc(N(/N=C/c3ccc([N+](=O)[O-])s3)C(=O)c3cccc([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C20H13N5O6S2/c1-31-14-5-7-16-17(10-14)33-20(22-16)23(21-11-15-6-8-18(32-15)25(29)30)19(26)12-3-2-4-13(9-12)24(27)28/h2-11H,1H3/b21-11+ |
| InChIKey | BPQOPNILIDMWBU-SRZZPIQSSA-N |
| XLogP | 4.86 |
| TPSA | 141.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|