C26H27N5O6S3 — CID 44946110
4-[butyl(ethyl)sulfamoyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide (PubChem CID 44946110) has the molecular formula C26H27N5O6S3 and a molecular weight of 601.73 g/mol. Its IUPAC name is 4-[butyl(ethyl)sulfamoyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 4-[butyl(ethyl)sulfamoyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44946110 |
| Molecular Formula | C26H27N5O6S3 |
| Molecular Weight | 601.73 g/mol |
| Exact Mass | 601.11 |
| IUPAC Name | 4-[butyl(ethyl)sulfamoyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
| SMILES | CCCCN(CC)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2ccc([N+](=O)[O-])s2)c2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C26H27N5O6S3/c1-4-6-15-29(5-2)40(35,36)21-11-7-18(8-12-21)25(32)30(27-17-20-10-14-24(38-20)31(33)34)26-28-22-13-9-19(37-3)16-23(22)39-26/h7-14,16-17H,4-6,15H2,1-3H3/b27-17+ |
| InChIKey | HOHQUUZDVUAOIH-WPWMEQJKSA-N |
| XLogP | 5.77 |
| TPSA | 135.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.73 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|