C25H24BrN5O7S3 — CID 44942476
4-[bis(2-methoxyethyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide (PubChem CID 44942476) has the molecular formula C25H24BrN5O7S3 and a molecular weight of 682.60 g/mol. Its IUPAC name is 4-[bis(2-methoxyethyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 4-[bis(2-methoxyethyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44942476 |
| Molecular Formula | C25H24BrN5O7S3 |
| Molecular Weight | 682.60 g/mol |
| Exact Mass | 681.00 |
| IUPAC Name | 4-[bis(2-methoxyethyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
| SMILES | COCCN(CCOC)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2ccc([N+](=O)[O-])s2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C25H24BrN5O7S3/c1-37-13-11-29(12-14-38-2)41(35,36)20-7-3-17(4-8-20)24(32)30(27-16-19-6-10-23(39-19)31(33)34)25-28-21-9-5-18(26)15-22(21)40-25/h3-10,15-16H,11-14H2,1-2H3/b27-16+ |
| InChIKey | XCMYLEAAUGHHRI-JVWAILMASA-N |
| XLogP | 4.99 |
| TPSA | 144.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|