C28H29N5O7S2 — CID 44944614
4-[bis(2-methoxyethyl)sulfamoyl]-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide (PubChem CID 44944614) has the molecular formula C28H29N5O7S2 and a molecular weight of 611.70 g/mol. Its IUPAC name is 4-[bis(2-methoxyethyl)sulfamoyl]-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 4-[bis(2-methoxyethyl)sulfamoyl]-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44944614 |
| Molecular Formula | C28H29N5O7S2 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.15 |
| IUPAC Name | 4-[bis(2-methoxyethyl)sulfamoyl]-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
| SMILES | COCCN(CCOC)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2ccc([N+](=O)[O-])cc2)c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C28H29N5O7S2/c1-20-4-13-25-26(18-20)41-28(30-25)32(29-19-21-5-9-23(10-6-21)33(35)36)27(34)22-7-11-24(12-8-22)42(37,38)31(14-16-39-2)15-17-40-3/h4-13,18-19H,14-17H2,1-3H3/b29-19+ |
| InChIKey | QESAFBHGEIYSDX-VUTHCHCSSA-N |
| XLogP | 4.48 |
| TPSA | 144.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|