C28H27N5O5S2 — CID 44944587
N-(6-methyl-1,3-benzothiazol-2-yl)-4-(4-methylpiperidin-1-yl)sulfonyl-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide (PubChem CID 44944587) has the molecular formula C28H27N5O5S2 and a molecular weight of 577.69 g/mol. Its IUPAC name is N-(6-methyl-1,3-benzothiazol-2-yl)-4-(4-methylpiperidin-1-yl)sulfonyl-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide.
| Compound Name | N-(6-methyl-1,3-benzothiazol-2-yl)-4-(4-methylpiperidin-1-yl)sulfonyl-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44944587 |
| Molecular Formula | C28H27N5O5S2 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | N-(6-methyl-1,3-benzothiazol-2-yl)-4-(4-methylpiperidin-1-yl)sulfonyl-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
| SMILES | Cc1ccc2nc(N(/N=C/c3ccc([N+](=O)[O-])cc3)C(=O)c3ccc(S(=O)(=O)N4CCC(C)CC4)cc3)sc2c1 |
| InChI | InChI=1S/C28H27N5O5S2/c1-19-13-15-31(16-14-19)40(37,38)24-10-6-22(7-11-24)27(34)32(28-30-25-12-3-20(2)17-26(25)39-28)29-18-21-4-8-23(9-5-21)33(35)36/h3-12,17-19H,13-16H2,1-2H3/b29-18+ |
| InChIKey | HYSSQCRLXNIUMP-RDRPBHBLSA-N |
| XLogP | 5.61 |
| TPSA | 126.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|