C24H22N4O3S3 — CID 16829547
N-(6-methyl-1,3-benzothiazol-2-yl)-4-pyrrolidin-1-ylsulfonyl-N-[(E)-thiophen-2-ylmethylideneamino]benzamide (PubChem CID 16829547) has the molecular formula C24H22N4O3S3 and a molecular weight of 510.67 g/mol. Its IUPAC name is N-(6-methyl-1,3-benzothiazol-2-yl)-4-pyrrolidin-1-ylsulfonyl-N-[(E)-thiophen-2-ylmethylideneamino]benzamide.
| Compound Name | N-(6-methyl-1,3-benzothiazol-2-yl)-4-pyrrolidin-1-ylsulfonyl-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 16829547 |
| Molecular Formula | C24H22N4O3S3 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | N-(6-methyl-1,3-benzothiazol-2-yl)-4-pyrrolidin-1-ylsulfonyl-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
| SMILES | Cc1ccc2nc(N(/N=C/c3cccs3)C(=O)c3ccc(S(=O)(=O)N4CCCC4)cc3)sc2c1 |
| InChI | InChI=1S/C24H22N4O3S3/c1-17-6-11-21-22(15-17)33-24(26-21)28(25-16-19-5-4-14-32-19)23(29)18-7-9-20(10-8-18)34(30,31)27-12-2-3-13-27/h4-11,14-16H,2-3,12-13H2,1H3/b25-16+ |
| InChIKey | VEPDFAFUOIYSQN-PCLIKHOPSA-N |
| XLogP | 5.13 |
| TPSA | 82.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|