C26H26N4O4S3 — CID 44944430
N-(6-methyl-1,3-benzothiazol-2-yl)-4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[(E)-thiophen-2-ylmethylideneamino]benzamide (PubChem CID 44944430) has the molecular formula C26H26N4O4S3 and a molecular weight of 554.72 g/mol. Its IUPAC name is N-(6-methyl-1,3-benzothiazol-2-yl)-4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[(E)-thiophen-2-ylmethylideneamino]benzamide.
| Compound Name | N-(6-methyl-1,3-benzothiazol-2-yl)-4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 44944430 |
| Molecular Formula | C26H26N4O4S3 |
| Molecular Weight | 554.72 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | N-(6-methyl-1,3-benzothiazol-2-yl)-4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
| SMILES | Cc1ccc2nc(N(/N=C/c3cccs3)C(=O)c3ccc(S(=O)(=O)N(C)CC4CCCO4)cc3)sc2c1 |
| InChI | InChI=1S/C26H26N4O4S3/c1-18-7-12-23-24(15-18)36-26(28-23)30(27-16-21-6-4-14-35-21)25(31)19-8-10-22(11-9-19)37(32,33)29(2)17-20-5-3-13-34-20/h4,6-12,14-16,20H,3,5,13,17H2,1-2H3/b27-16+ |
| InChIKey | FINYITNFUKNNQM-JVWAILMASA-N |
| XLogP | 5.15 |
| TPSA | 92.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.72 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|