C22H17N3O3S2 — CID 44944399
N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 44944399) has the molecular formula C22H17N3O3S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 44944399 |
| Molecular Formula | C22H17N3O3S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | Cc1ccc2nc(N(/N=C/c3cccs3)C(=O)c3ccc4c(c3)OCCO4)sc2c1 |
| InChI | InChI=1S/C22H17N3O3S2/c1-14-4-6-17-20(11-14)30-22(24-17)25(23-13-16-3-2-10-29-16)21(26)15-5-7-18-19(12-15)28-9-8-27-18/h2-7,10-13H,8-9H2,1H3/b23-13+ |
| InChIKey | CYWSFHINELXSTF-YDZHTSKRSA-N |
| XLogP | 5.12 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|