C19H11Br2N3OS2 — CID 44941908
3-bromo-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide (PubChem CID 44941908) has the molecular formula C19H11Br2N3OS2 and a molecular weight of 521.26 g/mol. Its IUPAC name is 3-bromo-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide.
| Compound Name | 3-bromo-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 44941908 |
| Molecular Formula | C19H11Br2N3OS2 |
| Molecular Weight | 521.26 g/mol |
| Exact Mass | 518.87 |
| IUPAC Name | 3-bromo-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
| SMILES | O=C(c1cccc(Br)c1)N(/N=C/c1cccs1)c1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C19H11Br2N3OS2/c20-13-4-1-3-12(9-13)18(25)24(22-11-15-5-2-8-26-15)19-23-16-7-6-14(21)10-17(16)27-19/h1-11H/b22-11+ |
| InChIKey | OVOAWDMEKBZDJQ-SSDVNMTOSA-N |
| XLogP | 6.56 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.26 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|