C20H14N4O3S2 — CID 44944353
N-(6-methyl-1,3-benzothiazol-2-yl)-3-nitro-N-[(E)-thiophen-2-ylmethylideneamino]benzamide (PubChem CID 44944353) has the molecular formula C20H14N4O3S2 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-(6-methyl-1,3-benzothiazol-2-yl)-3-nitro-N-[(E)-thiophen-2-ylmethylideneamino]benzamide.
| Compound Name | N-(6-methyl-1,3-benzothiazol-2-yl)-3-nitro-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 44944353 |
| Molecular Formula | C20H14N4O3S2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | N-(6-methyl-1,3-benzothiazol-2-yl)-3-nitro-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
| SMILES | Cc1ccc2nc(N(/N=C/c3cccs3)C(=O)c3cccc([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C20H14N4O3S2/c1-13-7-8-17-18(10-13)29-20(22-17)23(21-12-16-6-3-9-28-16)19(25)14-4-2-5-15(11-14)24(26)27/h2-12H,1H3/b21-12+ |
| InChIKey | UHKYVLUMCHEEBD-CIAFOILYSA-N |
| XLogP | 5.26 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|