C22H15BrN4O3S — CID 44941997
N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-3-nitrobenzamide (PubChem CID 44941997) has the molecular formula C22H15BrN4O3S and a molecular weight of 495.36 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-3-nitrobenzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 44941997 |
| Molecular Formula | C22H15BrN4O3S |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-3-nitrobenzamide |
| SMILES | Cc1ccc(/C=N/N(C(=O)c2cccc([N+](=O)[O-])c2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C22H15BrN4O3S/c1-14-5-7-15(8-6-14)13-24-26(21(28)16-3-2-4-18(11-16)27(29)30)22-25-19-10-9-17(23)12-20(19)31-22/h2-13H,1H3/b24-13+ |
| InChIKey | BQQIOCGKFQCNEM-ZMOGYAJESA-N |
| XLogP | 5.96 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|