C27H17BrN4O4S — CID 44942160
N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]-3-phenoxybenzamide (PubChem CID 44942160) has the molecular formula C27H17BrN4O4S and a molecular weight of 573.43 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]-3-phenoxybenzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]-3-phenoxybenzamide |
|---|---|
| PubChem CID | 44942160 |
| Molecular Formula | C27H17BrN4O4S |
| Molecular Weight | 573.43 g/mol |
| Exact Mass | 572.02 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]-3-phenoxybenzamide |
| SMILES | O=C(c1cccc(Oc2ccccc2)c1)N(/N=C/c1ccc([N+](=O)[O-])cc1)c1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C27H17BrN4O4S/c28-20-11-14-24-25(16-20)37-27(30-24)31(29-17-18-9-12-21(13-10-18)32(34)35)26(33)19-5-4-8-23(15-19)36-22-6-2-1-3-7-22/h1-17H/b29-17+ |
| InChIKey | AUZYCRYOHSBXEY-STBIYBPSSA-N |
| XLogP | 7.44 |
| TPSA | 97.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.43 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|