C28H20N4O4S — CID 44945757
N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]-4-phenylbenzamide (PubChem CID 44945757) has the molecular formula C28H20N4O4S and a molecular weight of 508.56 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]-4-phenylbenzamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]-4-phenylbenzamide |
|---|---|
| PubChem CID | 44945757 |
| Molecular Formula | C28H20N4O4S |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]-4-phenylbenzamide |
| SMILES | COc1ccc2nc(N(/N=C/c3ccc([N+](=O)[O-])cc3)C(=O)c3ccc(-c4ccccc4)cc3)sc2c1 |
| InChI | InChI=1S/C28H20N4O4S/c1-36-24-15-16-25-26(17-24)37-28(30-25)31(29-18-19-7-13-23(14-8-19)32(34)35)27(33)22-11-9-21(10-12-22)20-5-3-2-4-6-20/h2-18H,1H3/b29-18+ |
| InChIKey | UPHRGKDKWISEPE-RDRPBHBLSA-N |
| XLogP | 6.56 |
| TPSA | 97.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|