C22H14N6O8S — CID 44945829
N-(6-methoxy-1,3-benzothiazol-2-yl)-3,5-dinitro-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide (PubChem CID 44945829) has the molecular formula C22H14N6O8S and a molecular weight of 522.46 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-3,5-dinitro-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-3,5-dinitro-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44945829 |
| Molecular Formula | C22H14N6O8S |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-3,5-dinitro-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
| SMILES | COc1ccc2nc(N(/N=C/c3ccc([N+](=O)[O-])cc3)C(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C22H14N6O8S/c1-36-18-6-7-19-20(11-18)37-22(24-19)25(23-12-13-2-4-15(5-3-13)26(30)31)21(29)14-8-16(27(32)33)10-17(9-14)28(34)35/h2-12H,1H3/b23-12+ |
| InChIKey | KMTQVUHKQWOEJQ-FSJBWODESA-N |
| XLogP | 4.71 |
| TPSA | 184.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|