C22H15FN4O4S — CID 44943335
N-(6-fluoro-1,3-benzothiazol-2-yl)-4-methoxy-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide (PubChem CID 44943335) has the molecular formula C22H15FN4O4S and a molecular weight of 450.45 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-4-methoxy-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-4-methoxy-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44943335 |
| Molecular Formula | C22H15FN4O4S |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-4-methoxy-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(C(=O)N(/N=C/c2ccc([N+](=O)[O-])cc2)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C22H15FN4O4S/c1-31-18-9-4-15(5-10-18)21(28)26(22-25-19-11-6-16(23)12-20(19)32-22)24-13-14-2-7-17(8-3-14)27(29)30/h2-13H,1H3/b24-13+ |
| InChIKey | DPYQUUFONVDLGT-ZMOGYAJESA-N |
| XLogP | 5.03 |
| TPSA | 97.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|