C25H15FN4O3S — CID 44943389
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]naphthalene-2-carboxamide (PubChem CID 44943389) has the molecular formula C25H15FN4O3S and a molecular weight of 470.49 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]naphthalene-2-carboxamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 44943389 |
| Molecular Formula | C25H15FN4O3S |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]naphthalene-2-carboxamide |
| SMILES | O=C(c1ccc2ccccc2c1)N(/N=C/c1ccc([N+](=O)[O-])cc1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C25H15FN4O3S/c26-20-9-12-22-23(14-20)34-25(28-22)29(27-15-16-5-10-21(11-6-16)30(32)33)24(31)19-8-7-17-3-1-2-4-18(17)13-19/h1-15H/b27-15+ |
| InChIKey | BXODPQYEMQZIDQ-JFLMPSFJSA-N |
| XLogP | 6.18 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|