C27H18FN3OS — CID 44942692
N-[(E)-benzylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-4-phenylbenzamide (PubChem CID 44942692) has the molecular formula C27H18FN3OS and a molecular weight of 451.53 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-4-phenylbenzamide.
| Compound Name | N-[(E)-benzylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 44942692 |
| Molecular Formula | C27H18FN3OS |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | N-[(E)-benzylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-4-phenylbenzamide |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)N(/N=C/c1ccccc1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C27H18FN3OS/c28-23-15-16-24-25(17-23)33-27(30-24)31(29-18-19-7-3-1-4-8-19)26(32)22-13-11-21(12-14-22)20-9-5-2-6-10-20/h1-18H/b29-18+ |
| InChIKey | AORAFDUOIZXFBB-RDRPBHBLSA-N |
| XLogP | 6.78 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|