C27H17BrFN3OS — CID 44942197
N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]-4-phenylbenzamide (PubChem CID 44942197) has the molecular formula C27H17BrFN3OS and a molecular weight of 530.42 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]-4-phenylbenzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]-4-phenylbenzamide |
|---|---|
| PubChem CID | 44942197 |
| Molecular Formula | C27H17BrFN3OS |
| Molecular Weight | 530.42 g/mol |
| Exact Mass | 529.03 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]-4-phenylbenzamide |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)N(/N=C/c1ccc(F)cc1)c1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C27H17BrFN3OS/c28-22-12-15-24-25(16-22)34-27(31-24)32(30-17-18-6-13-23(29)14-7-18)26(33)21-10-8-20(9-11-21)19-4-2-1-3-5-19/h1-17H/b30-17+ |
| InChIKey | ZNWLPWBENSTZPQ-OCSSWDANSA-N |
| XLogP | 7.55 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.42 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|