C26H24BrN3OS — CID 44942058
N-(6-bromo-1,3-benzothiazol-2-yl)-4-tert-butyl-N-[(E)-(4-methylphenyl)methylideneamino]benzamide (PubChem CID 44942058) has the molecular formula C26H24BrN3OS and a molecular weight of 506.47 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-4-tert-butyl-N-[(E)-(4-methylphenyl)methylideneamino]benzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-tert-butyl-N-[(E)-(4-methylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44942058 |
| Molecular Formula | C26H24BrN3OS |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-tert-butyl-N-[(E)-(4-methylphenyl)methylideneamino]benzamide |
| SMILES | Cc1ccc(/C=N/N(C(=O)c2ccc(C(C)(C)C)cc2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C26H24BrN3OS/c1-17-5-7-18(8-6-17)16-28-30(25-29-22-14-13-21(27)15-23(22)32-25)24(31)19-9-11-20(12-10-19)26(2,3)4/h5-16H,1-4H3/b28-16+ |
| InChIKey | IEGHQKBANMKSPU-LQKURTRISA-N |
| XLogP | 7.35 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|