C24H18BrN3O3S — CID 44944041
methyl 4-[[(E)-(4-bromophenyl)methylideneamino]-(6-methyl-1,3-benzothiazol-2-yl)carbamoyl]benzoate (PubChem CID 44944041) has the molecular formula C24H18BrN3O3S and a molecular weight of 508.40 g/mol. Its IUPAC name is methyl 4-[[(E)-(4-bromophenyl)methylideneamino]-(6-methyl-1,3-benzothiazol-2-yl)carbamoyl]benzoate.
| Compound Name | methyl 4-[[(E)-(4-bromophenyl)methylideneamino]-(6-methyl-1,3-benzothiazol-2-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 44944041 |
| Molecular Formula | C24H18BrN3O3S |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | methyl 4-[[(E)-(4-bromophenyl)methylideneamino]-(6-methyl-1,3-benzothiazol-2-yl)carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N(/N=C/c2ccc(Br)cc2)c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C24H18BrN3O3S/c1-15-3-12-20-21(13-15)32-24(27-20)28(26-14-16-4-10-19(25)11-5-16)22(29)17-6-8-18(9-7-17)23(30)31-2/h3-14H,1-2H3/b26-14+ |
| InChIKey | XGGNYMIQSHFMMJ-VULFUBBASA-N |
| XLogP | 5.83 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|