C20H12BrCl2N3OS2 — CID 44944046
N-[(E)-(4-bromophenyl)methylideneamino]-2,5-dichloro-N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide (PubChem CID 44944046) has the molecular formula C20H12BrCl2N3OS2 and a molecular weight of 525.28 g/mol. Its IUPAC name is N-[(E)-(4-bromophenyl)methylideneamino]-2,5-dichloro-N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide.
| Compound Name | N-[(E)-(4-bromophenyl)methylideneamino]-2,5-dichloro-N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 44944046 |
| Molecular Formula | C20H12BrCl2N3OS2 |
| Molecular Weight | 525.28 g/mol |
| Exact Mass | 522.90 |
| IUPAC Name | N-[(E)-(4-bromophenyl)methylideneamino]-2,5-dichloro-N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide |
| SMILES | Cc1ccc2nc(N(/N=C/c3ccc(Br)cc3)C(=O)c3cc(Cl)sc3Cl)sc2c1 |
| InChI | InChI=1S/C20H12BrCl2N3OS2/c1-11-2-7-15-16(8-11)28-20(25-15)26(19(27)14-9-17(22)29-18(14)23)24-10-12-3-5-13(21)6-4-12/h2-10H,1H3/b24-10+ |
| InChIKey | HHZDUDYWDJJXDR-YSURURNPSA-N |
| XLogP | 7.42 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.28 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|