C23H13Cl2N3O3S2 — CID 44945064
2,5-dichloro-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]thiophene-3-carboxamide (PubChem CID 44945064) has the molecular formula C23H13Cl2N3O3S2 and a molecular weight of 514.42 g/mol. Its IUPAC name is 2,5-dichloro-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 44945064 |
| Molecular Formula | C23H13Cl2N3O3S2 |
| Molecular Weight | 514.42 g/mol |
| Exact Mass | 512.98 |
| IUPAC Name | 2,5-dichloro-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]thiophene-3-carboxamide |
| SMILES | Cc1ccc2nc(N(/N=C/c3coc4ccccc4c3=O)C(=O)c3cc(Cl)sc3Cl)sc2c1 |
| InChI | InChI=1S/C23H13Cl2N3O3S2/c1-12-6-7-16-18(8-12)32-23(27-16)28(22(30)15-9-19(24)33-21(15)25)26-10-13-11-31-17-5-3-2-4-14(17)20(13)29/h2-11H,1H3/b26-10+ |
| InChIKey | PSVPXTRIZUVABL-NSKAYECMSA-N |
| XLogP | 6.76 |
| TPSA | 75.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.42 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|