C25H16BrN3O3S — CID 44945018
3-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide (PubChem CID 44945018) has the molecular formula C25H16BrN3O3S and a molecular weight of 518.39 g/mol. Its IUPAC name is 3-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide.
| Compound Name | 3-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44945018 |
| Molecular Formula | C25H16BrN3O3S |
| Molecular Weight | 518.39 g/mol |
| Exact Mass | 517.01 |
| IUPAC Name | 3-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide |
| SMILES | Cc1ccc2nc(N(/N=C/c3coc4ccccc4c3=O)C(=O)c3cccc(Br)c3)sc2c1 |
| InChI | InChI=1S/C25H16BrN3O3S/c1-15-9-10-20-22(11-15)33-25(28-20)29(24(31)16-5-4-6-18(26)12-16)27-13-17-14-32-21-8-3-2-7-19(21)23(17)30/h2-14H,1H3/b27-13+ |
| InChIKey | RPFUTJJYDNVNRN-UVHMKAGCSA-N |
| XLogP | 6.15 |
| TPSA | 75.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.39 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|