C27H22N4O3S — CID 44945079
4-(dimethylamino)-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide (PubChem CID 44945079) has the molecular formula C27H22N4O3S and a molecular weight of 482.57 g/mol. Its IUPAC name is 4-(dimethylamino)-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide.
| Compound Name | 4-(dimethylamino)-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44945079 |
| Molecular Formula | C27H22N4O3S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 4-(dimethylamino)-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide |
| SMILES | Cc1ccc2nc(N(/N=C/c3coc4ccccc4c3=O)C(=O)c3ccc(N(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C27H22N4O3S/c1-17-8-13-22-24(14-17)35-27(29-22)31(26(33)18-9-11-20(12-10-18)30(2)3)28-15-19-16-34-23-7-5-4-6-21(23)25(19)32/h4-16H,1-3H3/b28-15+ |
| InChIKey | DDWMZHBKDBKGRO-RWPZCVJISA-N |
| XLogP | 5.46 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|