C25H16N4O6S — CID 44946229
N-(6-methoxy-1,3-benzothiazol-2-yl)-4-nitro-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide (PubChem CID 44946229) has the molecular formula C25H16N4O6S and a molecular weight of 500.49 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-4-nitro-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-4-nitro-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44946229 |
| Molecular Formula | C25H16N4O6S |
| Molecular Weight | 500.49 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-4-nitro-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide |
| SMILES | COc1ccc2nc(N(/N=C/c3coc4ccccc4c3=O)C(=O)c3ccc([N+](=O)[O-])cc3)sc2c1 |
| InChI | InChI=1S/C25H16N4O6S/c1-34-18-10-11-20-22(12-18)36-25(27-20)28(24(31)15-6-8-17(9-7-15)29(32)33)26-13-16-14-35-21-5-3-2-4-19(21)23(16)30/h2-14H,1H3/b26-13+ |
| InChIKey | IWNZVOXSKMVNCX-LGJNPRDNSA-N |
| XLogP | 5.00 |
| TPSA | 128.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|