C27H18N4O6S — CID 44946250
(E)-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]prop-2-enamide (PubChem CID 44946250) has the molecular formula C27H18N4O6S and a molecular weight of 526.53 g/mol. Its IUPAC name is (E)-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]prop-2-enamide.
| Compound Name | (E)-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]prop-2-enamide |
|---|---|
| PubChem CID | 44946250 |
| Molecular Formula | C27H18N4O6S |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | (E)-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]prop-2-enamide |
| SMILES | COc1ccc2nc(N(/N=C/c3coc4ccccc4c3=O)C(=O)/C=C/c3cccc([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C27H18N4O6S/c1-36-20-10-11-22-24(14-20)38-27(29-22)30(25(32)12-9-17-5-4-6-19(13-17)31(34)35)28-15-18-16-37-23-8-3-2-7-21(23)26(18)33/h2-16H,1H3/b12-9+,28-15+ |
| InChIKey | PLHASPNWSMLQFA-GUNDNOKVSA-N |
| XLogP | 5.40 |
| TPSA | 128.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|