C22H15N5O7S — CID 44946178
(E)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 44946178) has the molecular formula C22H15N5O7S and a molecular weight of 493.46 g/mol. Its IUPAC name is (E)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 44946178 |
| Molecular Formula | C22H15N5O7S |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | (E)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | COc1ccc2nc(N(/N=C/c3ccc([N+](=O)[O-])o3)C(=O)/C=C/c3ccc([N+](=O)[O-])cc3)sc2c1 |
| InChI | InChI=1S/C22H15N5O7S/c1-33-16-7-9-18-19(12-16)35-22(24-18)25(23-13-17-8-11-21(34-17)27(31)32)20(28)10-4-14-2-5-15(6-3-14)26(29)30/h2-13H,1H3/b10-4+,23-13+ |
| InChIKey | DEAADZCBIZRLSL-MOGPEYIJSA-N |
| XLogP | 4.79 |
| TPSA | 154.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|