C21H13FN4O4S — CID 44943099
(E)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 44943099) has the molecular formula C21H13FN4O4S and a molecular weight of 436.42 g/mol. Its IUPAC name is (E)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 44943099 |
| Molecular Formula | C21H13FN4O4S |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | (E)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-furan-2-ylmethylideneamino]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)N(/N=C/c1ccco1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C21H13FN4O4S/c22-15-6-9-18-19(12-15)31-21(24-18)25(23-13-17-2-1-11-30-17)20(27)10-5-14-3-7-16(8-4-14)26(28)29/h1-13H/b10-5+,23-13+ |
| InChIKey | VMWUMOZQFYUDPJ-OQTRGCLQSA-N |
| XLogP | 5.02 |
| TPSA | 101.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|